C20H18F2N4O — CID 143600802
N-[(1E)-3-(1H-benzimidazol-2-yl)-1-(methylamino)penta-1,3-dien-2-yl]-2,6-difluorobenzamide (PubChem CID 143600802) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[(1E)-3-(1H-benzimidazol-2-yl)-1-(methylamino)penta-1,3-dien-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[(1E)-3-(1H-benzimidazol-2-yl)-1-(methylamino)penta-1,3-dien-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 143600802 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(1E)-3-(1H-benzimidazol-2-yl)-1-(methylamino)penta-1,3-dien-2-yl]-2,6-difluorobenzamide |
| SMILES | CC=C(/C(=C\NC)NC(=O)c1c(F)cccc1F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H18F2N4O/c1-3-12(19-24-15-9-4-5-10-16(15)25-19)17(11-23-2)26-20(27)18-13(21)7-6-8-14(18)22/h3-11,23H,1-2H3,(H,24,25)(H,26,27)/b12-3?,17-11+ |
| InChIKey | AIACGFNYDHOEIA-FJRNPGPNSA-N |
| XLogP | 3.74 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|