C23H36N4 — CID 143600899
(1E)-3-(1H-benzimidazol-2-yl)-1-N-methyl-2-N-(3-propylhex-1-en-2-yl)buta-1,3-diene-1,2-diamine;ethane (PubChem CID 143600899) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is (1E)-3-(1H-benzimidazol-2-yl)-1-N-methyl-2-N-(3-propylhex-1-en-2-yl)buta-1,3-diene-1,2-diamine;ethane.
| Compound Name | (1E)-3-(1H-benzimidazol-2-yl)-1-N-methyl-2-N-(3-propylhex-1-en-2-yl)buta-1,3-diene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143600899 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (1E)-3-(1H-benzimidazol-2-yl)-1-N-methyl-2-N-(3-propylhex-1-en-2-yl)buta-1,3-diene-1,2-diamine;ethane |
| SMILES | C=C(/C(=C\NC)NC(=C)C(CCC)CCC)c1nc2ccccc2[nH]1.CC |
| InChI | InChI=1S/C21H30N4.C2H6/c1-6-10-17(11-7-2)16(4)23-20(14-22-5)15(3)21-24-18-12-8-9-13-19(18)25-21;1-2/h8-9,12-14,17,22-23H,3-4,6-7,10-11H2,1-2,5H3,(H,24,25);1-2H3/b20-14+; |
| InChIKey | VSFUWLGLMDWCLS-RANVTSCRSA-N |
| XLogP | 5.98 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|