C31H28ClN3O3 — CID 155004338
2-[(3E,5Z)-3-(1H-benzimidazol-2-yl)-6-chlorohexa-1,3,5-trien-2-yl]-5-[[(1S)-1-phenylbutyl]carbamoyl]benzoic acid (PubChem CID 155004338) has the molecular formula C31H28ClN3O3 and a molecular weight of 526.04 g/mol. Its IUPAC name is 2-[(3E,5Z)-3-(1H-benzimidazol-2-yl)-6-chlorohexa-1,3,5-trien-2-yl]-5-[[(1S)-1-phenylbutyl]carbamoyl]benzoic acid.
| Compound Name | 2-[(3E,5Z)-3-(1H-benzimidazol-2-yl)-6-chlorohexa-1,3,5-trien-2-yl]-5-[[(1S)-1-phenylbutyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 155004338 |
| Molecular Formula | C31H28ClN3O3 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[(3E,5Z)-3-(1H-benzimidazol-2-yl)-6-chlorohexa-1,3,5-trien-2-yl]-5-[[(1S)-1-phenylbutyl]carbamoyl]benzoic acid |
| SMILES | C=C(/C(=C\C=C/Cl)c1nc2ccccc2[nH]1)c1ccc(C(=O)N[C@@H](CCC)c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C31H28ClN3O3/c1-3-10-26(21-11-5-4-6-12-21)35-30(36)22-16-17-23(25(19-22)31(37)38)20(2)24(13-9-18-32)29-33-27-14-7-8-15-28(27)34-29/h4-9,11-19,26H,2-3,10H2,1H3,(H,33,34)(H,35,36)(H,37,38)/b18-9-,24-13+/t26-/m0/s1 |
| InChIKey | SFFFZXNZTIDSKY-GDOVGKDSSA-N |
| XLogP | 7.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|