C31H29ClN4O2 — CID 155004380
4-[(1R)-2-(1H-benzimidazol-2-yl)-6-chlorocyclohexa-2,4-dien-1-yl]-3-(1-hydroxyethenyl)-N-(1-pyridin-3-ylbutyl)benzamide (PubChem CID 155004380) has the molecular formula C31H29ClN4O2 and a molecular weight of 525.05 g/mol. Its IUPAC name is 4-[(1R)-2-(1H-benzimidazol-2-yl)-6-chlorocyclohexa-2,4-dien-1-yl]-3-(1-hydroxyethenyl)-N-(1-pyridin-3-ylbutyl)benzamide.
| Compound Name | 4-[(1R)-2-(1H-benzimidazol-2-yl)-6-chlorocyclohexa-2,4-dien-1-yl]-3-(1-hydroxyethenyl)-N-(1-pyridin-3-ylbutyl)benzamide |
|---|---|
| PubChem CID | 155004380 |
| Molecular Formula | C31H29ClN4O2 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 4-[(1R)-2-(1H-benzimidazol-2-yl)-6-chlorocyclohexa-2,4-dien-1-yl]-3-(1-hydroxyethenyl)-N-(1-pyridin-3-ylbutyl)benzamide |
| SMILES | C=C(O)c1cc(C(=O)NC(CCC)c2cccnc2)ccc1[C@@H]1C(c2nc3ccccc3[nH]2)=CC=CC1Cl |
| InChI | InChI=1S/C31H29ClN4O2/c1-3-8-26(21-9-7-16-33-18-21)36-31(38)20-14-15-22(24(17-20)19(2)37)29-23(10-6-11-25(29)32)30-34-27-12-4-5-13-28(27)35-30/h4-7,9-18,25-26,29,37H,2-3,8H2,1H3,(H,34,35)(H,36,38)/t25?,26?,29-/m1/s1 |
| InChIKey | JDMGYSUXQOOXTP-YITPRAEKSA-N |
| XLogP | 7.10 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|