C16H19NO2 — CID 143940081
methyl 3-[C-methyl-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]carbonimidoyl]benzoate (PubChem CID 143940081) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 3-[C-methyl-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]carbonimidoyl]benzoate.
| Compound Name | methyl 3-[C-methyl-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]carbonimidoyl]benzoate |
|---|---|
| PubChem CID | 143940081 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 3-[C-methyl-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]carbonimidoyl]benzoate |
| SMILES | C/C=C/C(C)=C\N=C(/C)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H19NO2/c1-5-7-12(2)11-17-13(3)14-8-6-9-15(10-14)16(18)19-4/h5-11H,1-4H3/b7-5+,12-11-,17-13+ |
| InChIKey | UHJPJZRAUFSKFH-GHFGNNICSA-N |
| XLogP | 3.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|