C22H36O3Si — CID 173401734
methyl-tris(2-methylhexa-2,4-dien-3-yloxy)silane (PubChem CID 173401734) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is methyl-tris(2-methylhexa-2,4-dien-3-yloxy)silane.
| Compound Name | methyl-tris(2-methylhexa-2,4-dien-3-yloxy)silane |
|---|---|
| PubChem CID | 173401734 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | methyl-tris(2-methylhexa-2,4-dien-3-yloxy)silane |
| SMILES | CC=CC(O[Si](C)(OC(C=CC)=C(C)C)OC(C=CC)=C(C)C)=C(C)C |
| InChI | InChI=1S/C22H36O3Si/c1-11-14-20(17(4)5)23-26(10,24-21(15-12-2)18(6)7)25-22(16-13-3)19(8)9/h11-16H,1-10H3 |
| InChIKey | YWMBDWISYMTSFF-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|