C14H26O3Si — CID 102525574
tert-butyl [(1E)-4-methyl-1-trimethylsilylpenta-1,3-dien-3-yl] carbonate (PubChem CID 102525574) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is tert-butyl [(1E)-4-methyl-1-trimethylsilylpenta-1,3-dien-3-yl] carbonate.
| Compound Name | tert-butyl [(1E)-4-methyl-1-trimethylsilylpenta-1,3-dien-3-yl] carbonate |
|---|---|
| PubChem CID | 102525574 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | tert-butyl [(1E)-4-methyl-1-trimethylsilylpenta-1,3-dien-3-yl] carbonate |
| SMILES | CC(C)=C(/C=C/[Si](C)(C)C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-11(2)12(9-10-18(6,7)8)16-13(15)17-14(3,4)5/h9-10H,1-8H3/b10-9+ |
| InChIKey | UEADQBYDLXYOQO-MDZDMXLPSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|