C12H25NO2Si — CID 10538218
tert-butyl N-[(E)-4-trimethylsilylbut-3-enyl]carbamate (PubChem CID 10538218) has the molecular formula C12H25NO2Si and a molecular weight of 243.42 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-trimethylsilylbut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-trimethylsilylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 10538218 |
| Molecular Formula | C12H25NO2Si |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | tert-butyl N-[(E)-4-trimethylsilylbut-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H25NO2Si/c1-12(2,3)15-11(14)13-9-7-8-10-16(4,5)6/h8,10H,7,9H2,1-6H3,(H,13,14)/b10-8+ |
| InChIKey | UAKGENYXOGGDLC-CSKARUKUSA-N |
| XLogP | 3.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|