C14H21F — CID 118946109
[(2E,4Z,6Z)-6-fluoro-7-methylnona-2,4,6-trien-2-yl]cyclobutane (PubChem CID 118946109) has the molecular formula C14H21F and a molecular weight of 208.32 g/mol. Its IUPAC name is [(2E,4Z,6Z)-6-fluoro-7-methylnona-2,4,6-trien-2-yl]cyclobutane.
| Compound Name | [(2E,4Z,6Z)-6-fluoro-7-methylnona-2,4,6-trien-2-yl]cyclobutane |
|---|---|
| PubChem CID | 118946109 |
| Molecular Formula | C14H21F |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [(2E,4Z,6Z)-6-fluoro-7-methylnona-2,4,6-trien-2-yl]cyclobutane |
| SMILES | CC/C(C)=C(F)/C=C\C=C(/C)C1CCC1 |
| InChI | InChI=1S/C14H21F/c1-4-11(2)14(15)10-5-7-12(3)13-8-6-9-13/h5,7,10,13H,4,6,8-9H2,1-3H3/b10-5-,12-7+,14-11- |
| InChIKey | HXNXTQAVJLVZMQ-JSCACNEQSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|