About CID 163697333
CID 163697333 (PubChem CID 163697333) has the molecular formula C5H6BClS
and a molecular weight of 144.44 g/mol.
Molecular Properties
| Compound Name | CID 163697333 |
| PubChem CID | 163697333 |
| Molecular Formula | C5H6BClS |
| Molecular Weight | 144.44 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | — |
| SMILES | [B]/C(Cl)=C(S)\C=C/C |
| InChI | InChI=1S/C5H6BClS/c1-2-3-4(8)5(6)7/h2-3,8H,1H3/b3-2-,5-4- |
| InChIKey | MONAQZLAZNSREB-LDIADDGTSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 163697333 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163697333?
The IUPAC name of CID 163697333 (CID 163697333) is not available.
What is the SMILES notation for CID 163697333?
The canonical SMILES for CID 163697333 is [B]/C(Cl)=C(S)\C=C/C.
What is the InChIKey of CID 163697333?
The InChIKey is MONAQZLAZNSREB-LDIADDGTSA-N. The full InChI is InChI=1S/C5H6BClS/c1-2-3-4(8)5(6)7/h2-3,8H,1H3/b3-2-,5-4-.
What are the key properties of CID 163697333?
CID 163697333 has a molecular weight of 144.44 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163697333 is sourced from PubChem (CID 163697333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).