propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate

C13H24O2 — CID 88632004

IUPACpropan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate
SMILESCC(C(=O)OC(C)C)=C(C(C)C)C(C)C
InChIInChI=1S/C13H24O2/c1-8(2)12(9(3)4)11(7)13(14)15-10(5)6/h8-10H,1-7H3
InChIKeyFLAUUDGSIRSBTJ-UHFFFAOYSA-N
MW212.33 g/mol
LogP3.57
Rot. Bonds4

About propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate

propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate (PubChem CID 88632004) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate.

Molecular Properties

Compound Namepropan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate
PubChem CID88632004
Molecular FormulaC13H24O2
Molecular Weight212.33 g/mol
Exact Mass212.18
IUPAC Namepropan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate
SMILESCC(C(=O)OC(C)C)=C(C(C)C)C(C)C
InChIInChI=1S/C13H24O2/c1-8(2)12(9(3)4)11(7)13(14)15-10(5)6/h8-10H,1-7H3
InChIKeyFLAUUDGSIRSBTJ-UHFFFAOYSA-N
XLogP3.57
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.33
LogP ≤ 53.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

propan-2-yl 2-methylprop-2-enoate
CID 146421311
propan-2-yl acetate;hydrochloride
CID 87336432
propan-2-yl 3-chloro-2-oxopropanoate
CID 45120097
(Z)-4-methyl-2-propan-2-yl-3-propan-2-yloxycarbonylpent-2-enoic acid
CID 174639148
2,4,5,6-tetramethylhept-4-en-3-one
CID 159203948
benzene;propan-2-yl 2-methylprop-2-enoate
CID 174524984
N-methoxymethanamine;propan-2-yl acetate
CID 158428721
propane;propan-2-yl acetate
CID 23325886
propan-2-yl (E)-2,3-dimethyl-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate;sulfane
CID 159952671
(Z)-3-methyl-4-oxo-4-propan-2-yloxybut-2-enoic acid
CID 139788321
propan-2-yl 2-imino-3-methylbutanoate
CID 90949713
propan-2-yl 2-silylprop-2-enoate
CID 173200883

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate?
The IUPAC name of propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate (CID 88632004) is propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate.
What is the SMILES notation for propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate?
The canonical SMILES for propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate is CC(C(=O)OC(C)C)=C(C(C)C)C(C)C.
What is the InChIKey of propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate?
The InChIKey is FLAUUDGSIRSBTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-8(2)12(9(3)4)11(7)13(14)15-10(5)6/h8-10H,1-7H3.
What are the key properties of propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate?
propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate has a molecular weight of 212.33 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2,4-dimethyl-3-propan-2-ylpent-2-enoate is sourced from PubChem (CID 88632004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).