About propan-2-yl 2-silylprop-2-enoate
propan-2-yl 2-silylprop-2-enoate (PubChem CID 173200883) has the molecular formula C6H12O2Si
and a molecular weight of 144.25 g/mol. Its IUPAC name is propan-2-yl 2-silylprop-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl 2-silylprop-2-enoate |
| PubChem CID | 173200883 |
| Molecular Formula | C6H12O2Si |
| Molecular Weight | 144.25 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | propan-2-yl 2-silylprop-2-enoate |
| SMILES | C=C([SiH3])C(=O)OC(C)C |
| InChI | InChI=1S/C6H12O2Si/c1-4(2)8-6(7)5(3)9/h4H,3H2,1-2,9H3 |
| InChIKey | QZYGQGLMCGVTKN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-silylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-silylprop-2-enoate?
The IUPAC name of propan-2-yl 2-silylprop-2-enoate (CID 173200883) is propan-2-yl 2-silylprop-2-enoate.
What is the SMILES notation for propan-2-yl 2-silylprop-2-enoate?
The canonical SMILES for propan-2-yl 2-silylprop-2-enoate is C=C([SiH3])C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-silylprop-2-enoate?
The InChIKey is QZYGQGLMCGVTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2Si/c1-4(2)8-6(7)5(3)9/h4H,3H2,1-2,9H3.
What are the key properties of propan-2-yl 2-silylprop-2-enoate?
propan-2-yl 2-silylprop-2-enoate has a molecular weight of 144.25 g/mol, XLogP of -0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-silylprop-2-enoate is sourced from PubChem (CID 173200883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).