C15H27NO4S — CID 159952671
propan-2-yl (E)-2,3-dimethyl-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate;sulfane (PubChem CID 159952671) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is propan-2-yl (E)-2,3-dimethyl-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate;sulfane.
| Compound Name | propan-2-yl (E)-2,3-dimethyl-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate;sulfane |
|---|---|
| PubChem CID | 159952671 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | propan-2-yl (E)-2,3-dimethyl-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate;sulfane |
| SMILES | CC(=O)C(NC(=O)/C(C)=C(\C)C(=O)OC(C)C)C(C)C.S |
| InChI | InChI=1S/C15H25NO4.H2S/c1-8(2)13(12(7)17)16-14(18)10(5)11(6)15(19)20-9(3)4;/h8-9,13H,1-7H3,(H,16,18);1H2/b11-10+; |
| InChIKey | OCHRZHAMRNPBCK-ASTDGNLGSA-N |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|