C13H21NO4 — CID 59571311
propan-2-yl (E)-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate (PubChem CID 59571311) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is propan-2-yl (E)-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate.
| Compound Name | propan-2-yl (E)-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 59571311 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | propan-2-yl (E)-4-[(2-methyl-4-oxopentan-3-yl)amino]-4-oxobut-2-enoate |
| SMILES | CC(=O)C(NC(=O)/C=C/C(=O)OC(C)C)C(C)C |
| InChI | InChI=1S/C13H21NO4/c1-8(2)13(10(5)15)14-11(16)6-7-12(17)18-9(3)4/h6-9,13H,1-5H3,(H,14,16)/b7-6+ |
| InChIKey | IEYDEYFTALVZRG-VOTSOKGWSA-N |
| XLogP | 1.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|