C23H31N3O10 — CID 19802949
[3-hydroxy-6-(2-methylprop-2-enoyloxy)-4-[2-(2-methylprop-2-enoyloxy)ethyl]-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)hexyl] 2-methylprop-2-enoate (PubChem CID 19802949) has the molecular formula C23H31N3O10 and a molecular weight of 509.51 g/mol. Its IUPAC name is [3-hydroxy-6-(2-methylprop-2-enoyloxy)-4-[2-(2-methylprop-2-enoyloxy)ethyl]-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)hexyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-6-(2-methylprop-2-enoyloxy)-4-[2-(2-methylprop-2-enoyloxy)ethyl]-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19802949 |
| Molecular Formula | C23H31N3O10 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [3-hydroxy-6-(2-methylprop-2-enoyloxy)-4-[2-(2-methylprop-2-enoyloxy)ethyl]-4-(2,4,6-trioxo-1,3,5-triazinan-1-yl)hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(O)C(CCOC(=O)C(=C)C)(CCOC(=O)C(=C)C)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H31N3O10/c1-13(2)17(28)34-10-7-16(27)23(8-11-35-18(29)14(3)4,9-12-36-19(30)15(5)6)26-21(32)24-20(31)25-22(26)33/h16,27H,1,3,5,7-12H2,2,4,6H3,(H2,24,25,31,32,33) |
| InChIKey | DXJRPDUJPPDWBF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 186.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|