C14H28O3Si — CID 154093182
(3-methoxysilyl-4-methyl-3-propan-2-ylpentyl) 2-methylprop-2-enoate (PubChem CID 154093182) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (3-methoxysilyl-4-methyl-3-propan-2-ylpentyl) 2-methylprop-2-enoate.
| Compound Name | (3-methoxysilyl-4-methyl-3-propan-2-ylpentyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154093182 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3-methoxysilyl-4-methyl-3-propan-2-ylpentyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC([SiH2]OC)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-10(2)13(15)17-9-8-14(11(3)4,12(5)6)18-16-7/h11-12H,1,8-9,18H2,2-7H3 |
| InChIKey | IERAIUCSHVFXJR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|