C10H20O4Si — CID 123567803
(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate (PubChem CID 123567803) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate.
| Compound Name | (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123567803 |
| Molecular Formula | C10H20O4Si |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(OC)(OC)[SiH2]C |
| InChI | InChI=1S/C10H20O4Si/c1-8(2)9(11)14-7-6-10(12-3,13-4)15-5/h1,6-7,15H2,2-5H3 |
| InChIKey | QHYPFQHOPQHCQF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|