(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate

C10H20O4Si — CID 123567803

IUPAC(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OCCC(OC)(OC)[SiH2]C
InChIInChI=1S/C10H20O4Si/c1-8(2)9(11)14-7-6-10(12-3,13-4)15-5/h1,6-7,15H2,2-5H3
InChIKeyQHYPFQHOPQHCQF-UHFFFAOYSA-N
MW232.35 g/mol
LogP0.66
Rot. Bonds7

About (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate

(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate (PubChem CID 123567803) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate.

Molecular Properties

Compound Name(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate
PubChem CID123567803
Molecular FormulaC10H20O4Si
Molecular Weight232.35 g/mol
Exact Mass232.11
IUPAC Name(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OCCC(OC)(OC)[SiH2]C
InChIInChI=1S/C10H20O4Si/c1-8(2)9(11)14-7-6-10(12-3,13-4)15-5/h1,6-7,15H2,2-5H3
InChIKeyQHYPFQHOPQHCQF-UHFFFAOYSA-N
XLogP0.66
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.35
LogP ≤ 50.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate?
The IUPAC name of (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate (CID 123567803) is (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate.
What is the SMILES notation for (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate?
The canonical SMILES for (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate is C=C(C)C(=O)OCCC(OC)(OC)[SiH2]C.
What is the InChIKey of (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate?
The InChIKey is QHYPFQHOPQHCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4Si/c1-8(2)9(11)14-7-6-10(12-3,13-4)15-5/h1,6-7,15H2,2-5H3.
What are the key properties of (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate?
(3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate has a molecular weight of 232.35 g/mol, XLogP of 0.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethoxy-3-methylsilylpropyl) 2-methylprop-2-enoate is sourced from PubChem (CID 123567803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).