C18H32N4O4S — CID 26415603
4-[1-[(3S)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]-N,N-diethylpiperidine-1-sulfonamide (PubChem CID 26415603) has the molecular formula C18H32N4O4S and a molecular weight of 400.55 g/mol. Its IUPAC name is 4-[1-[(3S)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]-N,N-diethylpiperidine-1-sulfonamide.
| Compound Name | 4-[1-[(3S)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]-N,N-diethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 26415603 |
| Molecular Formula | C18H32N4O4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-[1-[(3S)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]-N,N-diethylpiperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC(C2CCN([C@H]3CC(=O)NC3=O)CC2)CC1 |
| InChI | InChI=1S/C18H32N4O4S/c1-3-21(4-2)27(25,26)22-11-7-15(8-12-22)14-5-9-20(10-6-14)16-13-17(23)19-18(16)24/h14-16H,3-13H2,1-2H3,(H,19,23,24)/t16-/m0/s1 |
| InChIKey | DLVORPFHIKUMDW-INIZCTEOSA-N |
| XLogP | 0.41 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|