C24H35FN4O4S — CID 16766499
N,N-diethyl-4-[1-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-sulfonamide (PubChem CID 16766499) has the molecular formula C24H35FN4O4S and a molecular weight of 494.63 g/mol. Its IUPAC name is N,N-diethyl-4-[1-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-[1-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 16766499 |
| Molecular Formula | C24H35FN4O4S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N,N-diethyl-4-[1-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]piperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC(C2CCN(C3CC(=O)N(c4ccc(F)cc4)C3=O)CC2)CC1 |
| InChI | InChI=1S/C24H35FN4O4S/c1-3-27(4-2)34(32,33)28-15-11-19(12-16-28)18-9-13-26(14-10-18)22-17-23(30)29(24(22)31)21-7-5-20(25)6-8-21/h5-8,18-19,22H,3-4,9-17H2,1-2H3 |
| InChIKey | IGIIMNPTSXFCGG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|