C23H26FN3O4S — CID 26370534
N-ethyl-N-[1-[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]benzenesulfonamide (PubChem CID 26370534) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is N-ethyl-N-[1-[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-ethyl-N-[1-[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 26370534 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-ethyl-N-[1-[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-4-yl]benzenesulfonamide |
| SMILES | CCN(C1CCN([C@H]2CC(=O)N(c3ccc(F)cc3)C2=O)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26FN3O4S/c1-2-26(32(30,31)20-6-4-3-5-7-20)18-12-14-25(15-13-18)21-16-22(28)27(23(21)29)19-10-8-17(24)9-11-19/h3-11,18,21H,2,12-16H2,1H3/t21-/m0/s1 |
| InChIKey | HOCYDYBNQTYCGN-NRFANRHFSA-N |
| XLogP | 2.63 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|