C24H23N5O4 — CID 176899227
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]methyl]-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 176899227) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]methyl]-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]methyl]-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 176899227 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]methyl]-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C1CCC(n2ncc3cc(CNC(=O)C4CNc5ccccc5C4)ccc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C24H23N5O4/c30-21-8-7-20(23(32)28-21)29-24(33)18-6-5-14(9-16(18)13-27-29)11-26-22(31)17-10-15-3-1-2-4-19(15)25-12-17/h1-6,9,13,17,20,25H,7-8,10-12H2,(H,26,31)(H,28,30,32) |
| InChIKey | ZIBYRJMDPTXHSX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|