C30H37N5O8 — CID 166142025
tert-butyl N-[3-[2-[2-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-6-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]carbamate (PubChem CID 166142025) has the molecular formula C30H37N5O8 and a molecular weight of 595.65 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-6-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-6-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 166142025 |
| Molecular Formula | C30H37N5O8 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[2-[[3-(2,6-dioxopiperidin-3-yl)-4-oxophthalazin-6-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(OCCOCCOCCNc2ccc3cnn(C4CCC(=O)NC4=O)c(=O)c3c2)c1 |
| InChI | InChI=1S/C30H37N5O8/c1-30(2,3)43-29(39)33-22-5-4-6-23(17-22)42-16-15-41-14-13-40-12-11-31-21-8-7-20-19-32-35(28(38)24(20)18-21)25-9-10-26(36)34-27(25)37/h4-8,17-19,25,31H,9-16H2,1-3H3,(H,33,39)(H,34,36,37) |
| InChIKey | RLJVXSOHQPRCMB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 159.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|