C19H23N7O5 — CID 166142063
3-[8-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1-oxophthalazin-2-yl]piperidine-2,6-dione (PubChem CID 166142063) has the molecular formula C19H23N7O5 and a molecular weight of 429.44 g/mol. Its IUPAC name is 3-[8-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1-oxophthalazin-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1-oxophthalazin-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166142063 |
| Molecular Formula | C19H23N7O5 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 3-[8-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1-oxophthalazin-2-yl]piperidine-2,6-dione |
| SMILES | [N-]=[N+]=NCCOCCOCCNc1cccc2cnn(C3CCC(=O)NC3=O)c(=O)c12 |
| InChI | InChI=1S/C19H23N7O5/c20-25-22-7-9-31-11-10-30-8-6-21-14-3-1-2-13-12-23-26(19(29)17(13)14)15-4-5-16(27)24-18(15)28/h1-3,12,15,21H,4-11H2,(H,24,27,28) |
| InChIKey | DVTFEEWXQRWBKT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|