C19H24N6O4 — CID 155680726
3-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155680726) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155680726 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [N-]=[N+]=NCCOCCOCCNc1cccc2cn(C3CCC(=O)NC3=O)cc12 |
| InChI | InChI=1S/C19H24N6O4/c20-24-22-7-9-29-11-10-28-8-6-21-16-3-1-2-14-12-25(13-15(14)16)17-4-5-18(26)23-19(17)27/h1-3,12-13,17,21H,4-11H2,(H,23,26,27) |
| InChIKey | KDHLCTLGMJPUSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|