C24H30N6O9 — CID 169451042
N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide (PubChem CID 169451042) has the molecular formula C24H30N6O9 and a molecular weight of 546.54 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide.
| Compound Name | N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide |
|---|---|
| PubChem CID | 169451042 |
| Molecular Formula | C24H30N6O9 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCNC(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H30N6O9/c25-29-27-7-9-37-11-13-39-15-14-38-12-10-36-8-6-26-21(32)16-2-1-3-17-20(16)24(35)30(23(17)34)18-4-5-19(31)28-22(18)33/h1-3,18H,4-15H2,(H,26,32)(H,28,31,33) |
| InChIKey | WNYACGIHHJZABP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 198.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|