C27H29N3O8 — CID 164615010
2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-N-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethyl]isoindole-4-carboxamide (PubChem CID 164615010) has the molecular formula C27H29N3O8 and a molecular weight of 523.54 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-N-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethyl]isoindole-4-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-N-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethyl]isoindole-4-carboxamide |
|---|---|
| PubChem CID | 164615010 |
| Molecular Formula | C27H29N3O8 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-N-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethyl]isoindole-4-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(C(=O)NCCOCCOCCOCc4ccccc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H29N3O8/c31-22-10-9-21(25(33)29-22)30-26(34)20-8-4-7-19(23(20)27(30)35)24(32)28-11-12-36-13-14-37-15-16-38-17-18-5-2-1-3-6-18/h1-8,21H,9-17H2,(H,28,32)(H,29,31,33) |
| InChIKey | QPWWJPRPPHFPDS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|