C14H13N3O3 — CID 166948259
2-[2-(2,6-dioxopiperidin-3-yl)indazol-5-yl]acetaldehyde (PubChem CID 166948259) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)indazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)indazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 166948259 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)indazol-5-yl]acetaldehyde |
| SMILES | O=CCc1ccc2nn(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C14H13N3O3/c18-6-5-9-1-2-11-10(7-9)8-17(16-11)12-3-4-13(19)15-14(12)20/h1-2,6-8,12H,3-5H2,(H,15,19,20) |
| InChIKey | RGYLZGNYDISLMF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|