C18H20N2O3 — CID 166946007
3-(3,3-dimethyl-2-oxo-6-prop-2-enylindol-1-yl)piperidine-2,6-dione (PubChem CID 166946007) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2-oxo-6-prop-2-enylindol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3,3-dimethyl-2-oxo-6-prop-2-enylindol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166946007 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(3,3-dimethyl-2-oxo-6-prop-2-enylindol-1-yl)piperidine-2,6-dione |
| SMILES | C=CCc1ccc2c(c1)N(C1CCC(=O)NC1=O)C(=O)C2(C)C |
| InChI | InChI=1S/C18H20N2O3/c1-4-5-11-6-7-12-14(10-11)20(17(23)18(12,2)3)13-8-9-15(21)19-16(13)22/h4,6-7,10,13H,1,5,8-9H2,2-3H3,(H,19,21,22) |
| InChIKey | KROKEFDTYVKUJF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|