C18H22N2O3 — CID 162504449
3-[5-(2,2-dimethylpropyl)-2-oxo-3H-indol-1-yl]piperidine-2,6-dione (PubChem CID 162504449) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylpropyl)-2-oxo-3H-indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(2,2-dimethylpropyl)-2-oxo-3H-indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504449 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[5-(2,2-dimethylpropyl)-2-oxo-3H-indol-1-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)Cc1ccc2c(c1)CC(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H22N2O3/c1-18(2,3)10-11-4-5-13-12(8-11)9-16(22)20(13)14-6-7-15(21)19-17(14)23/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,19,21,23) |
| InChIKey | XBNFLQYHDOLMEX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|