C22H22N2O4 — CID 166816641
4-(2,2-dimethylpropyl)-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 166816641) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 4-(2,2-dimethylpropyl)-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 166816641 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)(C)Cc1ccc2cccc3c2c1C(=O)N(C1CCC(=O)NC1=O)C3=O |
| InChI | InChI=1S/C22H22N2O4/c1-22(2,3)11-13-8-7-12-5-4-6-14-17(12)18(13)21(28)24(20(14)27)15-9-10-16(25)23-19(15)26/h4-8,15H,9-11H2,1-3H3,(H,23,25,26) |
| InChIKey | XXPWFNJYNYGUBY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|