C13H11BrN2O2 — CID 91547260
3-(5-bromoisoindol-2-yl)piperidine-2,6-dione (PubChem CID 91547260) has the molecular formula C13H11BrN2O2 and a molecular weight of 307.15 g/mol. Its IUPAC name is 3-(5-bromoisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-bromoisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 91547260 |
| Molecular Formula | C13H11BrN2O2 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-(5-bromoisoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc3ccc(Br)cc3c2)C(=O)N1 |
| InChI | InChI=1S/C13H11BrN2O2/c14-10-2-1-8-6-16(7-9(8)5-10)11-3-4-12(17)15-13(11)18/h1-2,5-7,11H,3-4H2,(H,15,17,18) |
| InChIKey | JWAAFOBHTGLPFL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|