C11H9BrN4O3 — CID 142596935
3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione (PubChem CID 142596935) has the molecular formula C11H9BrN4O3 and a molecular weight of 325.12 g/mol. Its IUPAC name is 3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 142596935 |
| Molecular Formula | C11H9BrN4O3 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-(7-bromo-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2nc3cc(Br)ccn3c2=O)C(=O)N1 |
| InChI | InChI=1S/C11H9BrN4O3/c12-6-3-4-15-8(5-6)14-16(11(15)19)7-1-2-9(17)13-10(7)18/h3-5,7H,1-2H2,(H,13,17,18) |
| InChIKey | YZEKNZCKZORYJR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|