C16H19IN4O4 — CID 146173226
3-[7-(5-iodopentoxy)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl]piperidine-2,6-dione (PubChem CID 146173226) has the molecular formula C16H19IN4O4 and a molecular weight of 458.26 g/mol. Its IUPAC name is 3-[7-(5-iodopentoxy)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(5-iodopentoxy)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146173226 |
| Molecular Formula | C16H19IN4O4 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 3-[7-(5-iodopentoxy)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2nc3cc(OCCCCCI)ccn3c2=O)C(=O)N1 |
| InChI | InChI=1S/C16H19IN4O4/c17-7-2-1-3-9-25-11-6-8-20-13(10-11)19-21(16(20)24)12-4-5-14(22)18-15(12)23/h6,8,10,12H,1-5,7,9H2,(H,18,22,23) |
| InChIKey | DOOQCAVGZCJNOB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|