C26H32N8O5 — CID 155600119
6-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]pentyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 155600119) has the molecular formula C26H32N8O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is 6-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]pentyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]pentyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155600119 |
| Molecular Formula | C26H32N8O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 6-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]pentyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCN(CCCCCOc3ccc4nn(C5CCC(=O)NC5=O)c(=O)n4c3)CC2)nc1 |
| InChI | InChI=1S/C26H32N8O5/c27-24(36)18-4-7-21(28-16-18)32-13-11-31(12-14-32)10-2-1-3-15-39-19-5-8-22-30-34(26(38)33(22)17-19)20-6-9-23(35)29-25(20)37/h4-5,7-8,16-17,20H,1-3,6,9-15H2,(H2,27,36)(H,29,35,37) |
| InChIKey | DMXYOPDUERJDID-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 157.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|