C40H41N5O5 — CID 135279228
3-[4-[4-[5-[4-(6-hydroxy-2-phenylnaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-6-oxopyrimidin-1-yl]piperidine-2,6-dione (PubChem CID 135279228) has the molecular formula C40H41N5O5 and a molecular weight of 671.80 g/mol. Its IUPAC name is 3-[4-[4-[5-[4-(6-hydroxy-2-phenylnaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-6-oxopyrimidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[5-[4-(6-hydroxy-2-phenylnaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-6-oxopyrimidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 135279228 |
| Molecular Formula | C40H41N5O5 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | 3-[4-[4-[5-[4-(6-hydroxy-2-phenylnaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-6-oxopyrimidin-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cnc(N3CCN(CCCCCOc4ccc(-c5c(-c6ccccc6)ccc6cc(O)ccc56)cc4)CC3)cc2=O)C(=O)N1 |
| InChI | InChI=1S/C40H41N5O5/c46-31-12-16-34-30(25-31)11-15-33(28-7-3-1-4-8-28)39(34)29-9-13-32(14-10-29)50-24-6-2-5-19-43-20-22-44(23-21-43)36-26-38(48)45(27-41-36)35-17-18-37(47)42-40(35)49/h1,3-4,7-16,25-27,35,46H,2,5-6,17-24H2,(H,42,47,49) |
| InChIKey | PZKBXJCMSYWCOE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|