C41H45BrN4O6S — CID 159455028
benzene;3-[6-[4-[4-[4-[(6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]butyl]piperazin-1-yl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione;hydrobromide (PubChem CID 159455028) has the molecular formula C41H45BrN4O6S and a molecular weight of 801.80 g/mol. Its IUPAC name is benzene;3-[6-[4-[4-[4-[(6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]butyl]piperazin-1-yl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione;hydrobromide.
| Compound Name | benzene;3-[6-[4-[4-[4-[(6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]butyl]piperazin-1-yl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione;hydrobromide |
|---|---|
| PubChem CID | 159455028 |
| Molecular Formula | C41H45BrN4O6S |
| Molecular Weight | 801.80 g/mol |
| Exact Mass | 800.22 |
| IUPAC Name | benzene;3-[6-[4-[4-[4-[(6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]butyl]piperazin-1-yl]-3-oxo-4,5-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione;hydrobromide |
| SMILES | Br.O=C1CCC(N2CC3=C(CCC(N4CCN(CCCCOc5ccc(Oc6csc7cc(O)ccc67)cc5)CC4)=C3)C2=O)C(=O)N1.c1ccccc1 |
| InChI | InChI=1S/C35H38N4O6S.C6H6.BrH/c40-25-4-10-29-31(22-46-32(29)20-25)45-27-7-5-26(6-8-27)44-18-2-1-13-37-14-16-38(17-15-37)24-3-9-28-23(19-24)21-39(35(28)43)30-11-12-33(41)36-34(30)42;1-2-4-6-5-3-1;/h4-8,10,19-20,22,30,40H,1-3,9,11-18,21H2,(H,36,41,42);1-6H;1H |
| InChIKey | MAJWRSXHNGEVQJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|