C45H48N4O5 — CID 170450341
3-[6-[4-[5-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170450341) has the molecular formula C45H48N4O5 and a molecular weight of 724.90 g/mol. Its IUPAC name is 3-[6-[4-[5-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[5-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170450341 |
| Molecular Formula | C45H48N4O5 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | 3-[6-[4-[5-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(CCCCCOc5ccc(C6=C(c7ccccc7)CCCc7cc(O)ccc76)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C45H48N4O5/c50-36-15-19-39-33(29-36)10-7-11-38(31-8-3-1-4-9-31)43(39)32-12-16-37(17-13-32)54-27-6-2-5-22-47-23-25-48(26-24-47)35-14-18-40-34(28-35)30-49(45(40)53)41-20-21-42(51)46-44(41)52/h1,3-4,8-9,12-19,28-29,41,50H,2,5-7,10-11,20-27,30H2,(H,46,51,52) |
| InChIKey | OZYUFFRYRUDVPC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|