C51H48N4O9S — CID 171446670
2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 171446670) has the molecular formula C51H48N4O9S and a molecular weight of 893.03 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171446670 |
| Molecular Formula | C51H48N4O9S |
| Molecular Weight | 893.03 g/mol |
| Exact Mass | 892.31 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3cc(OCc4ccccc4)ccc3c2Oc2ccc(OCCCCN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C51H48N4O9S/c1-65(60,61)41-18-9-35(10-19-41)42-20-11-36-31-40(63-33-34-7-3-2-4-8-34)17-22-43(36)48(42)64-39-15-13-38(14-16-39)62-30-6-5-25-53-26-28-54(29-27-53)37-12-21-44-45(32-37)51(59)55(50(44)58)46-23-24-47(56)52-49(46)57/h2-4,7-22,31-32,46H,5-6,23-30,33H2,1H3,(H,52,56,57) |
| InChIKey | XSXNUBLVLCNNGN-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.03 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|