C45H52N2O7S — CID 170775307
tert-butyl 2-[5-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate (PubChem CID 170775307) has the molecular formula C45H52N2O7S and a molecular weight of 764.99 g/mol. Its IUPAC name is tert-butyl 2-[5-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate.
| Compound Name | tert-butyl 2-[5-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate |
|---|---|
| PubChem CID | 170775307 |
| Molecular Formula | C45H52N2O7S |
| Molecular Weight | 764.99 g/mol |
| Exact Mass | 764.35 |
| IUPAC Name | tert-butyl 2-[5-[4-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCCN1CCN(c2ccc(Oc3c(-c4ccc(S(C)(=O)=O)cc4)ccc4cc(OCc5ccccc5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C45H52N2O7S/c1-45(2,3)54-43(48)33-51-30-10-6-9-25-46-26-28-47(29-27-46)37-16-18-38(19-17-37)53-44-41(35-13-21-40(22-14-35)55(4,49)50)23-15-36-31-39(20-24-42(36)44)52-32-34-11-7-5-8-12-34/h5,7-8,11-24,31H,6,9-10,25-30,32-33H2,1-4H3 |
| InChIKey | FXVAOOBQBLUDMO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.99 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|