C39H42N2O8S — CID 174218055
2-[2-[ethyl-[2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethylcarbamic acid (PubChem CID 174218055) has the molecular formula C39H42N2O8S and a molecular weight of 698.84 g/mol. Its IUPAC name is 2-[2-[ethyl-[2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[ethyl-[2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 174218055 |
| Molecular Formula | C39H42N2O8S |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 2-[2-[ethyl-[2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethylcarbamic acid |
| SMILES | CCN(CCOCCNC(=O)O)CCOc1ccc(Oc2c(-c3ccc(S(C)(=O)=O)cc3)ccc3cc(OCc4ccccc4)ccc23)cc1 |
| InChI | InChI=1S/C39H42N2O8S/c1-3-41(22-25-46-24-21-40-39(42)43)23-26-47-32-12-14-33(15-13-32)49-38-36(30-9-17-35(18-10-30)50(2,44)45)19-11-31-27-34(16-20-37(31)38)48-28-29-7-5-4-6-8-29/h4-20,27,40H,3,21-26,28H2,1-2H3,(H,42,43) |
| InChIKey | DCHMKHZSTYTOJQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|