C30H31NO5S — CID 122631776
5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol (PubChem CID 122631776) has the molecular formula C30H31NO5S and a molecular weight of 517.65 g/mol. Its IUPAC name is 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol.
| Compound Name | 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 122631776 |
| Molecular Formula | C30H31NO5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol |
| SMILES | CCC1CN(CCOc2ccc(Oc3c(-c4ccc(S(C)(=O)=O)cc4)ccc4cc(O)ccc34)cc2)C1 |
| InChI | InChI=1S/C30H31NO5S/c1-3-21-19-31(20-21)16-17-35-25-8-10-26(11-9-25)36-30-28(14-6-23-18-24(32)7-15-29(23)30)22-4-12-27(13-5-22)37(2,33)34/h4-15,18,21,32H,3,16-17,19-20H2,1-2H3 |
| InChIKey | FWNJSGHEHGBNMB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |