C31H30Cl2N2O4S — CID 68521290
5-[4-[2-(azepin-1-yl)ethylamino]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol;dihydrochloride (PubChem CID 68521290) has the molecular formula C31H30Cl2N2O4S and a molecular weight of 597.56 g/mol. Its IUPAC name is 5-[4-[2-(azepin-1-yl)ethylamino]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol;dihydrochloride.
| Compound Name | 5-[4-[2-(azepin-1-yl)ethylamino]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 68521290 |
| Molecular Formula | C31H30Cl2N2O4S |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 5-[4-[2-(azepin-1-yl)ethylamino]phenoxy]-6-(4-methylsulfonylphenyl)naphthalen-2-ol;dihydrochloride |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(NCCN3C=CC=CC=C3)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C31H28N2O4S.2ClH/c1-38(35,36)28-14-6-23(7-15-28)29-16-8-24-22-26(34)11-17-30(24)31(29)37-27-12-9-25(10-13-27)32-18-21-33-19-4-2-3-5-20-33;;/h2-17,19-20,22,32,34H,18,21H2,1H3;2*1H |
| InChIKey | BKOGOCMDCZHCKW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_B(4)', 'substructure': 'N/A'} |
|---|