C38H46N2O7S — CID 170775286
tert-butyl 2-[5-[4-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate (PubChem CID 170775286) has the molecular formula C38H46N2O7S and a molecular weight of 674.86 g/mol. Its IUPAC name is tert-butyl 2-[5-[4-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate.
| Compound Name | tert-butyl 2-[5-[4-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate |
|---|---|
| PubChem CID | 170775286 |
| Molecular Formula | C38H46N2O7S |
| Molecular Weight | 674.86 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | tert-butyl 2-[5-[4-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenyl]piperazin-1-yl]pentoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCCN1CCN(c2ccc(Oc3c(-c4ccc(S(C)(=O)=O)cc4)ccc4cc(O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C38H46N2O7S/c1-38(2,3)47-36(42)27-45-25-7-5-6-20-39-21-23-40(24-22-39)30-11-14-32(15-12-30)46-37-34(18-10-29-26-31(41)13-19-35(29)37)28-8-16-33(17-9-28)48(4,43)44/h8-19,26,41H,5-7,20-25,27H2,1-4H3 |
| InChIKey | RZWAYNJZSHOOBW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.86 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|