C45H46N4O8S — CID 171058185
3-[6-[4-[4-[4-[6-methoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171058185) has the molecular formula C45H46N4O8S and a molecular weight of 802.95 g/mol. Its IUPAC name is 3-[6-[4-[4-[4-[6-methoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-[4-[6-methoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171058185 |
| Molecular Formula | C45H46N4O8S |
| Molecular Weight | 802.95 g/mol |
| Exact Mass | 802.30 |
| IUPAC Name | 3-[6-[4-[4-[4-[6-methoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc2c(Oc3ccc(OCCCCN4CCN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)CC4)cc3)c(-c3ccc(S(C)(=O)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C45H46N4O8S/c1-55-36-13-18-39-31(28-36)7-16-38(30-5-14-37(15-6-30)58(2,53)54)43(39)57-35-11-9-34(10-12-35)56-26-4-3-21-47-22-24-48(25-23-47)33-8-17-40-32(27-33)29-49(45(40)52)41-19-20-42(50)46-44(41)51/h5-18,27-28,41H,3-4,19-26,29H2,1-2H3,(H,46,50,51) |
| InChIKey | SWAQUGKINDTVQE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.95 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|