C46H48N4O8S — CID 171446810
3-[5-[4-[2-[4-[6-butoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171446810) has the molecular formula C46H48N4O8S and a molecular weight of 816.98 g/mol. Its IUPAC name is 3-[5-[4-[2-[4-[6-butoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[2-[4-[6-butoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171446810 |
| Molecular Formula | C46H48N4O8S |
| Molecular Weight | 816.98 g/mol |
| Exact Mass | 816.32 |
| IUPAC Name | 3-[5-[4-[2-[4-[6-butoxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCCCOc1ccc2c(Oc3ccc(OCCN4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6)CC4)cc3)c(-c3ccc(S(C)(=O)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C46H48N4O8S/c1-3-4-26-56-37-14-18-40-32(28-37)8-17-39(31-6-15-38(16-7-31)59(2,54)55)44(40)58-36-12-10-35(11-13-36)57-27-25-48-21-23-49(24-22-48)34-9-5-33-30-50(46(53)41(33)29-34)42-19-20-43(51)47-45(42)52/h5-18,28-29,42H,3-4,19-27,30H2,1-2H3,(H,47,51,52) |
| InChIKey | TZJHWVMZZLEGAN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.98 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|