C33H31NO5S — CID 170775294
N-methyl-2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethanamine (PubChem CID 170775294) has the molecular formula C33H31NO5S and a molecular weight of 553.68 g/mol. Its IUPAC name is N-methyl-2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethanamine.
| Compound Name | N-methyl-2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethanamine |
|---|---|
| PubChem CID | 170775294 |
| Molecular Formula | C33H31NO5S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-methyl-2-[4-[2-(4-methylsulfonylphenyl)-6-phenylmethoxynaphthalen-1-yl]oxyphenoxy]ethanamine |
| SMILES | CNCCOc1ccc(Oc2c(-c3ccc(S(C)(=O)=O)cc3)ccc3cc(OCc4ccccc4)ccc23)cc1 |
| InChI | InChI=1S/C33H31NO5S/c1-34-20-21-37-27-11-13-28(14-12-27)39-33-31(25-8-16-30(17-9-25)40(2,35)36)18-10-26-22-29(15-19-32(26)33)38-23-24-6-4-3-5-7-24/h3-19,22,34H,20-21,23H2,1-2H3 |
| InChIKey | NGJRJRNAGCWKIM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|