C30H31NO3 — CID 146428238
5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylphenyl)naphthalen-2-ol (PubChem CID 146428238) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylphenyl)naphthalen-2-ol.
| Compound Name | 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 146428238 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 5-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenoxy]-6-(4-methylphenyl)naphthalen-2-ol |
| SMILES | CCC1CN(CCOc2ccc(Oc3c(-c4ccc(C)cc4)ccc4cc(O)ccc34)cc2)C1 |
| InChI | InChI=1S/C30H31NO3/c1-3-22-19-31(20-22)16-17-33-26-10-12-27(13-11-26)34-30-28(23-6-4-21(2)5-7-23)14-8-24-18-25(32)9-15-29(24)30/h4-15,18,22,32H,3,16-17,19-20H2,1-2H3 |
| InChIKey | HMQVWJVTWGVLRK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |