C28H32N6O7 — CID 167227289
tert-butyl 6-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyamino]methyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 167227289) has the molecular formula C28H32N6O7 and a molecular weight of 564.60 g/mol. Its IUPAC name is tert-butyl 6-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyamino]methyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyamino]methyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 167227289 |
| Molecular Formula | C28H32N6O7 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | tert-butyl 6-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyamino]methyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CCN(CNOc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)nc1 |
| InChI | InChI=1S/C28H32N6O7/c1-28(2,3)40-27(39)17-4-8-22(29-15-17)33-12-10-32(11-13-33)16-30-41-18-5-6-19-20(14-18)26(38)34(25(19)37)21-7-9-23(35)31-24(21)36/h4-6,8,14-15,21,30H,7,9-13,16H2,1-3H3,(H,31,35,36) |
| InChIKey | DFBIIBZHHJYSML-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|