C39H35FN4O10 — CID 158130854
tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethyl]benzoate;2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione (PubChem CID 158130854) has the molecular formula C39H35FN4O10 and a molecular weight of 738.73 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethyl]benzoate;2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione.
| Compound Name | tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethyl]benzoate;2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 158130854 |
| Molecular Formula | C39H35FN4O10 |
| Molecular Weight | 738.73 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | tert-butyl 4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethyl]benzoate;2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
| SMILES | CC(C)(C)OC(=O)c1ccc(CCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1.O=C1CCC(N2C(=O)c3ccc(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26N2O6.C13H9FN2O4/c1-26(2,3)34-25(33)17-9-6-15(7-10-17)4-5-16-8-11-18-19(14-16)24(32)28(23(18)31)20-12-13-21(29)27-22(20)30;14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h6-11,14,20H,4-5,12-13H2,1-3H3,(H,27,29,30);1-2,5,9H,3-4H2,(H,15,17,18) |
| InChIKey | FSTHNVDZMHXILE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|