C24H22N2O7S — CID 146914502
2-(2,6-dioxopiperidin-3-yl)-5-[3-(4-ethylsulfonylphenyl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 146914502) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-(4-ethylsulfonylphenyl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(4-ethylsulfonylphenyl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146914502 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(4-ethylsulfonylphenyl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H22N2O7S/c1-2-34(32,33)16-7-5-15(6-8-16)20(27)11-4-14-3-9-17-18(13-14)24(31)26(23(17)30)19-10-12-21(28)25-22(19)29/h3,5-9,13,19H,2,4,10-12H2,1H3,(H,25,28,29) |
| InChIKey | ABYUANWLXIKLFT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|